C15H19NOS — CID 170480310
S-[4-(1,2,3,4-tetrahydroisoquinolin-5-yl)but-3-enyl] ethanethioate (PubChem CID 170480310) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is S-[4-(1,2,3,4-tetrahydroisoquinolin-5-yl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(1,2,3,4-tetrahydroisoquinolin-5-yl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480310 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | S-[4-(1,2,3,4-tetrahydroisoquinolin-5-yl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cccc2c1CCNC2 |
| InChI | InChI=1S/C15H19NOS/c1-12(17)18-10-3-2-5-13-6-4-7-14-11-16-9-8-15(13)14/h2,4-7,16H,3,8-11H2,1H3 |
| InChIKey | OEPGXCKIQUHWRS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|