C8H8N2O3 — CID 170481532
4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-enal (PubChem CID 170481532) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-enal.
| Compound Name | 4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-enal |
|---|---|
| PubChem CID | 170481532 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-enal |
| SMILES | O=CCC=Cc1c(O)nc[nH]c1=O |
| InChI | InChI=1S/C8H8N2O3/c11-4-2-1-3-6-7(12)9-5-10-8(6)13/h1,3-5H,2H2,(H2,9,10,12,13) |
| InChIKey | OWPBNRINSCOKTH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|