C9H7Cl2NO — CID 170481597
4-(2,6-dichloro-3-pyridinyl)but-3-enal (PubChem CID 170481597) has the molecular formula C9H7Cl2NO and a molecular weight of 216.07 g/mol. Its IUPAC name is 4-(2,6-dichloro-3-pyridinyl)but-3-enal.
| Compound Name | 4-(2,6-dichloro-3-pyridinyl)but-3-enal |
|---|---|
| PubChem CID | 170481597 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 4-(2,6-dichloro-3-pyridinyl)but-3-enal |
| SMILES | O=CCC=Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C9H7Cl2NO/c10-8-5-4-7(9(11)12-8)3-1-2-6-13/h1,3-6H,2H2 |
| InChIKey | WWJKIDBXEMGVQH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|