About 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal
4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal (PubChem CID 170481971) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal.
Molecular Properties
| Compound Name | 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal |
| PubChem CID | 170481971 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal |
| SMILES | Cc1nc(N)c(N)cc1C=CCC=O |
| InChI | InChI=1S/C10H13N3O/c1-7-8(4-2-3-5-14)6-9(11)10(12)13-7/h2,4-6H,3,11H2,1H3,(H2,12,13) |
| InChIKey | DYAODQPTZWGXLB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal?
The IUPAC name of 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal (CID 170481971) is 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal.
What is the SMILES notation for 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal?
The canonical SMILES for 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal is Cc1nc(N)c(N)cc1C=CCC=O.
What is the InChIKey of 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal?
The InChIKey is DYAODQPTZWGXLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-7-8(4-2-3-5-14)6-9(11)10(12)13-7/h2,4-6H,3,11H2,1H3,(H2,12,13).
What are the key properties of 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal?
4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal has a molecular weight of 191.23 g/mol, XLogP of 1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-diamino-2-methyl-3-pyridinyl)but-3-enal is sourced from PubChem (CID 170481971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).