C10H9N3O — CID 170482011
4-(1H-pyrazolo[4,5-b]pyridin-6-yl)but-3-enal (PubChem CID 170482011) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-(1H-pyrazolo[4,5-b]pyridin-6-yl)but-3-enal.
| Compound Name | 4-(1H-pyrazolo[4,5-b]pyridin-6-yl)but-3-enal |
|---|---|
| PubChem CID | 170482011 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 4-(1H-pyrazolo[4,5-b]pyridin-6-yl)but-3-enal |
| SMILES | O=CCC=Cc1cnc2cn[nH]c2c1 |
| InChI | InChI=1S/C10H9N3O/c14-4-2-1-3-8-5-9-10(11-6-8)7-12-13-9/h1,3-7H,2H2,(H,12,13) |
| InChIKey | FHQXUAFMHCPBGJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|