About 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal
4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal (PubChem CID 170482014) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal.
Molecular Properties
| Compound Name | 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal |
| PubChem CID | 170482014 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal |
| SMILES | O=CCC=Cc1[nH]nc2ncccc12 |
| InChI | InChI=1S/C10H9N3O/c14-7-2-1-5-9-8-4-3-6-11-10(8)13-12-9/h1,3-7H,2H2,(H,11,12,13) |
| InChIKey | ZCZCXWKMYPLLBX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal?
The IUPAC name of 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal (CID 170482014) is 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal.
What is the SMILES notation for 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal?
The canonical SMILES for 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal is O=CCC=Cc1[nH]nc2ncccc12.
What is the InChIKey of 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal?
The InChIKey is ZCZCXWKMYPLLBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c14-7-2-1-5-9-8-4-3-6-11-10(8)13-12-9/h1,3-7H,2H2,(H,11,12,13).
What are the key properties of 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal?
4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal has a molecular weight of 187.20 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2H-pyrazolo[3,4-b]pyridin-3-yl)but-3-enal is sourced from PubChem (CID 170482014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).