C11H8ClF3O2 — CID 170484042
4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-enoic acid (PubChem CID 170484042) has the molecular formula C11H8ClF3O2 and a molecular weight of 264.63 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-enoic acid.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-enoic acid |
|---|---|
| PubChem CID | 170484042 |
| Molecular Formula | C11H8ClF3O2 |
| Molecular Weight | 264.63 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-enoic acid |
| SMILES | O=C(O)CC=Cc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8ClF3O2/c12-9-5-7(2-1-3-10(16)17)4-8(6-9)11(13,14)15/h1-2,4-6H,3H2,(H,16,17) |
| InChIKey | QPHLMWSBPPKDMO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |