C12H12N4O — CID 170485478
6-(4-azidobut-1-enyl)-2-methyl-1,3-benzoxazole (PubChem CID 170485478) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 6-(4-azidobut-1-enyl)-2-methyl-1,3-benzoxazole.
| Compound Name | 6-(4-azidobut-1-enyl)-2-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 170485478 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 6-(4-azidobut-1-enyl)-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2ccc(C=CCCN=[N+]=[N-])cc2o1 |
| InChI | InChI=1S/C12H12N4O/c1-9-15-11-6-5-10(8-12(11)17-9)4-2-3-7-14-16-13/h2,4-6,8H,3,7H2,1H3 |
| InChIKey | HBPCGODQEZEQMR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|