About 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine
3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 170485479) has the molecular formula C9H10N8
and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 170485479 |
| Molecular Formula | C9H10N8 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | [N-]=[N+]=NCCC=Cc1[nH]nc2ncnc(N)c12 |
| InChI | InChI=1S/C9H10N8/c10-8-7-6(3-1-2-4-14-17-11)15-16-9(7)13-5-12-8/h1,3,5H,2,4H2,(H3,10,12,13,15,16) |
| InChIKey | MPKXTSPWMFFTCG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 129.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (CID 170485479) is 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine is [N-]=[N+]=NCCC=Cc1[nH]nc2ncnc(N)c12.
What is the InChIKey of 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is MPKXTSPWMFFTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N8/c10-8-7-6(3-1-2-4-14-17-11)15-16-9(7)13-5-12-8/h1,3,5H,2,4H2,(H3,10,12,13,15,16).
What are the key properties of 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine?
3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 230.23 g/mol, XLogP of 1.65, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-azidobut-1-enyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 170485479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).