C13H15N3O3 — CID 170486122
2-[5-(4-azidobut-1-enyl)-2-methoxyphenyl]acetic acid (PubChem CID 170486122) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[5-(4-azidobut-1-enyl)-2-methoxyphenyl]acetic acid.
| Compound Name | 2-[5-(4-azidobut-1-enyl)-2-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 170486122 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[5-(4-azidobut-1-enyl)-2-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(C=CCCN=[N+]=[N-])cc1CC(=O)O |
| InChI | InChI=1S/C13H15N3O3/c1-19-12-6-5-10(4-2-3-7-15-16-14)8-11(12)9-13(17)18/h2,4-6,8H,3,7,9H2,1H3,(H,17,18) |
| InChIKey | SUOTUZOVPHKVMZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|