C10H17N3 — CID 170486607
4-(1-propan-2-ylpyrazol-4-yl)but-3-en-1-amine (PubChem CID 170486607) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 4-(1-propan-2-ylpyrazol-4-yl)but-3-en-1-amine.
| Compound Name | 4-(1-propan-2-ylpyrazol-4-yl)but-3-en-1-amine |
|---|---|
| PubChem CID | 170486607 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 4-(1-propan-2-ylpyrazol-4-yl)but-3-en-1-amine |
| SMILES | CC(C)n1cc(C=CCCN)cn1 |
| InChI | InChI=1S/C10H17N3/c1-9(2)13-8-10(7-12-13)5-3-4-6-11/h3,5,7-9H,4,6,11H2,1-2H3 |
| InChIKey | UQSSXWKHHHRUDQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |