About 4-(4-aminobut-1-enyl)-3,5-difluoroaniline
4-(4-aminobut-1-enyl)-3,5-difluoroaniline (PubChem CID 170487004) has the molecular formula C10H12F2N2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-(4-aminobut-1-enyl)-3,5-difluoroaniline.
Molecular Properties
| Compound Name | 4-(4-aminobut-1-enyl)-3,5-difluoroaniline |
| PubChem CID | 170487004 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 4-(4-aminobut-1-enyl)-3,5-difluoroaniline |
| SMILES | NCCC=Cc1c(F)cc(N)cc1F |
| InChI | InChI=1S/C10H12F2N2/c11-9-5-7(14)6-10(12)8(9)3-1-2-4-13/h1,3,5-6H,2,4,13-14H2 |
| InChIKey | SENRHIQTBHOJLX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminobut-1-enyl)-3,5-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminobut-1-enyl)-3,5-difluoroaniline?
The IUPAC name of 4-(4-aminobut-1-enyl)-3,5-difluoroaniline (CID 170487004) is 4-(4-aminobut-1-enyl)-3,5-difluoroaniline.
What is the SMILES notation for 4-(4-aminobut-1-enyl)-3,5-difluoroaniline?
The canonical SMILES for 4-(4-aminobut-1-enyl)-3,5-difluoroaniline is NCCC=Cc1c(F)cc(N)cc1F.
What is the InChIKey of 4-(4-aminobut-1-enyl)-3,5-difluoroaniline?
The InChIKey is SENRHIQTBHOJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2/c11-9-5-7(14)6-10(12)8(9)3-1-2-4-13/h1,3,5-6H,2,4,13-14H2.
What are the key properties of 4-(4-aminobut-1-enyl)-3,5-difluoroaniline?
4-(4-aminobut-1-enyl)-3,5-difluoroaniline has a molecular weight of 198.22 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminobut-1-enyl)-3,5-difluoroaniline is sourced from PubChem (CID 170487004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).