C12H14FNO2 — CID 170487423
2-[3-(4-aminobut-1-enyl)-4-fluorophenyl]acetic acid (PubChem CID 170487423) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is 2-[3-(4-aminobut-1-enyl)-4-fluorophenyl]acetic acid.
| Compound Name | 2-[3-(4-aminobut-1-enyl)-4-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 170487423 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-[3-(4-aminobut-1-enyl)-4-fluorophenyl]acetic acid |
| SMILES | NCCC=Cc1cc(CC(=O)O)ccc1F |
| InChI | InChI=1S/C12H14FNO2/c13-11-5-4-9(8-12(15)16)7-10(11)3-1-2-6-14/h1,3-5,7H,2,6,8,14H2,(H,15,16) |
| InChIKey | GBLUYMXNNZCDQK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |