C13H17NO2 — CID 170487615
4-[2-(1,3-dioxolan-2-yl)phenyl]but-3-en-1-amine (PubChem CID 170487615) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 4-[2-(1,3-dioxolan-2-yl)phenyl]but-3-en-1-amine.
| Compound Name | 4-[2-(1,3-dioxolan-2-yl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 170487615 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 4-[2-(1,3-dioxolan-2-yl)phenyl]but-3-en-1-amine |
| SMILES | NCCC=Cc1ccccc1C1OCCO1 |
| InChI | InChI=1S/C13H17NO2/c14-8-4-3-6-11-5-1-2-7-12(11)13-15-9-10-16-13/h1-3,5-7,13H,4,8-10,14H2 |
| InChIKey | IXUPDHSIFXNSKL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |