C13H15N3 — CID 170487633
4-[4-(1H-pyrazol-5-yl)phenyl]but-3-en-1-amine (PubChem CID 170487633) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-[4-(1H-pyrazol-5-yl)phenyl]but-3-en-1-amine.
| Compound Name | 4-[4-(1H-pyrazol-5-yl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 170487633 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-[4-(1H-pyrazol-5-yl)phenyl]but-3-en-1-amine |
| SMILES | NCCC=Cc1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C13H15N3/c14-9-2-1-3-11-4-6-12(7-5-11)13-8-10-15-16-13/h1,3-8,10H,2,9,14H2,(H,15,16) |
| InChIKey | QEGKGOJLFXLCIF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |