About N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide
N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide (PubChem CID 170488825) has the molecular formula C12H14N4O
and a molecular weight of 230.27 g/mol. Its IUPAC name is N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide.
Molecular Properties
| Compound Name | N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide |
| PubChem CID | 170488825 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1cnc2nc[nH]c2c1 |
| InChI | InChI=1S/C12H14N4O/c1-9(17)13-5-3-2-4-10-6-11-12(14-7-10)16-8-15-11/h2,4,6-8H,3,5H2,1H3,(H,13,17)(H,14,15,16) |
| InChIKey | BPTYLWGPSIIMLD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide?
The IUPAC name of N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide (CID 170488825) is N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide.
What is the SMILES notation for N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide?
The canonical SMILES for N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide is CC(=O)NCCC=Cc1cnc2nc[nH]c2c1.
What is the InChIKey of N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide?
The InChIKey is BPTYLWGPSIIMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O/c1-9(17)13-5-3-2-4-10-6-11-12(14-7-10)16-8-15-11/h2,4,6-8H,3,5H2,1H3,(H,13,17)(H,14,15,16).
What are the key properties of N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide?
N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide has a molecular weight of 230.27 g/mol, XLogP of 1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1H-imidazo[4,5-b]pyridin-6-yl)but-3-enyl]acetamide is sourced from PubChem (CID 170488825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).