C19H23N5O2 — CID 170491449
tert-butyl N-[4-[4-(5-amino-4-cyanopyrazol-1-yl)phenyl]but-3-enyl]carbamate (PubChem CID 170491449) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(5-amino-4-cyanopyrazol-1-yl)phenyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(5-amino-4-cyanopyrazol-1-yl)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170491449 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | tert-butyl N-[4-[4-(5-amino-4-cyanopyrazol-1-yl)phenyl]but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1ccc(-n2ncc(C#N)c2N)cc1 |
| InChI | InChI=1S/C19H23N5O2/c1-19(2,3)26-18(25)22-11-5-4-6-14-7-9-16(10-8-14)24-17(21)15(12-20)13-23-24/h4,6-10,13H,5,11,21H2,1-3H3,(H,22,25) |
| InChIKey | ZFMLOILQFZCQGO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|