C10H14N2O2S — CID 170495819
methyl 2-[4-(methylamino)but-1-enyl]-1,3-thiazole-5-carboxylate (PubChem CID 170495819) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is methyl 2-[4-(methylamino)but-1-enyl]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[4-(methylamino)but-1-enyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 170495819 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl 2-[4-(methylamino)but-1-enyl]-1,3-thiazole-5-carboxylate |
| SMILES | CNCCC=Cc1ncc(C(=O)OC)s1 |
| InChI | InChI=1S/C10H14N2O2S/c1-11-6-4-3-5-9-12-7-8(15-9)10(13)14-2/h3,5,7,11H,4,6H2,1-2H3 |
| InChIKey | PDBAWZMADKHDRQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|