C14H20N2O2 — CID 170496630
ethyl 4-amino-3-[4-(methylamino)but-1-enyl]benzoate (PubChem CID 170496630) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is ethyl 4-amino-3-[4-(methylamino)but-1-enyl]benzoate.
| Compound Name | ethyl 4-amino-3-[4-(methylamino)but-1-enyl]benzoate |
|---|---|
| PubChem CID | 170496630 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | ethyl 4-amino-3-[4-(methylamino)but-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(N)c(C=CCCNC)c1 |
| InChI | InChI=1S/C14H20N2O2/c1-3-18-14(17)12-7-8-13(15)11(10-12)6-4-5-9-16-2/h4,6-8,10,16H,3,5,9,15H2,1-2H3 |
| InChIKey | RSQLBWPENUIGHK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|