C11H15BrN2 — CID 170497399
5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine (PubChem CID 170497399) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine.
| Compound Name | 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 170497399 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine |
| SMILES | Cc1cc(N)nc(C)c1C=CCCBr |
| InChI | InChI=1S/C11H15BrN2/c1-8-7-11(13)14-9(2)10(8)5-3-4-6-12/h3,5,7H,4,6H2,1-2H3,(H2,13,14) |
| InChIKey | ZFCXAAJDXIXFLA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|