About 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine
5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine (PubChem CID 170497399) has the molecular formula C11H15BrN2
and a molecular weight of 255.16 g/mol. Its IUPAC name is 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine |
| PubChem CID | 170497399 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine |
| SMILES | Cc1cc(N)nc(C)c1C=CCCBr |
| InChI | InChI=1S/C11H15BrN2/c1-8-7-11(13)14-9(2)10(8)5-3-4-6-12/h3,5,7H,4,6H2,1-2H3,(H2,13,14) |
| InChIKey | ZFCXAAJDXIXFLA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine?
The IUPAC name of 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine (CID 170497399) is 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine.
What is the SMILES notation for 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine?
The canonical SMILES for 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine is Cc1cc(N)nc(C)c1C=CCCBr.
What is the InChIKey of 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine?
The InChIKey is ZFCXAAJDXIXFLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2/c1-8-7-11(13)14-9(2)10(8)5-3-4-6-12/h3,5,7H,4,6H2,1-2H3,(H2,13,14).
What are the key properties of 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine?
5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine has a molecular weight of 255.16 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromobut-1-enyl)-4,6-dimethylpyridin-2-amine is sourced from PubChem (CID 170497399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).