C17H15BrClN7OS — CID 17049808
2-[[4-amino-5-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-bromophenyl)acetamide (PubChem CID 17049808) has the molecular formula C17H15BrClN7OS and a molecular weight of 480.78 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-bromophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-bromophenyl)acetamide |
|---|---|
| PubChem CID | 17049808 |
| Molecular Formula | C17H15BrClN7OS |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-bromophenyl)acetamide |
| SMILES | Nn1c(N/N=C/c2ccccc2Cl)nnc1SCC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C17H15BrClN7OS/c18-12-5-3-6-13(8-12)22-15(27)10-28-17-25-24-16(26(17)20)23-21-9-11-4-1-2-7-14(11)19/h1-9H,10,20H2,(H,22,27)(H,23,24)/b21-9+ |
| InChIKey | LTZGACUBZQWJKR-ZVBGSRNCSA-N |
| XLogP | 3.58 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|