C11H9F2NO4 — CID 170501542
methyl 4-(2,4-difluoro-5-nitrophenyl)but-3-enoate (PubChem CID 170501542) has the molecular formula C11H9F2NO4 and a molecular weight of 257.19 g/mol. Its IUPAC name is methyl 4-(2,4-difluoro-5-nitrophenyl)but-3-enoate.
| Compound Name | methyl 4-(2,4-difluoro-5-nitrophenyl)but-3-enoate |
|---|---|
| PubChem CID | 170501542 |
| Molecular Formula | C11H9F2NO4 |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | methyl 4-(2,4-difluoro-5-nitrophenyl)but-3-enoate |
| SMILES | COC(=O)CC=Cc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C11H9F2NO4/c1-18-11(15)4-2-3-7-5-10(14(16)17)9(13)6-8(7)12/h2-3,5-6H,4H2,1H3 |
| InChIKey | WEXOPXZBNDWGQO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|