C20H29NO5 — CID 170502797
3-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-4-methyl-6-(3-methylbutyl)pyran-2-one (PubChem CID 170502797) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 3-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-4-methyl-6-(3-methylbutyl)pyran-2-one.
| Compound Name | 3-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-4-methyl-6-(3-methylbutyl)pyran-2-one |
|---|---|
| PubChem CID | 170502797 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 3-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-4-methyl-6-(3-methylbutyl)pyran-2-one |
| SMILES | Cc1cc(CCC(C)C)oc(=O)c1C(=O)N1C[C@H]2C[C@H](O)[C@@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C20H29NO5/c1-11(2)4-5-15-6-12(3)18(20(25)26-15)19(24)21-9-13-7-16(22)17(23)8-14(13)10-21/h6,11,13-14,16-17,22-23H,4-5,7-10H2,1-3H3/t13-,14+,16-,17-/m0/s1 |
| InChIKey | KOEJPONREDQRES-FSDCSDTHSA-N |
| XLogP | 1.74 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |