C23H27NO5 — CID 170503144
3-[(3aR,6aS)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-4-methyl-6-(3-phenylpropyl)pyran-2-one (PubChem CID 170503144) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 3-[(3aR,6aS)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-4-methyl-6-(3-phenylpropyl)pyran-2-one.
| Compound Name | 3-[(3aR,6aS)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-4-methyl-6-(3-phenylpropyl)pyran-2-one |
|---|---|
| PubChem CID | 170503144 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 3-[(3aR,6aS)-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-5-carbonyl]-4-methyl-6-(3-phenylpropyl)pyran-2-one |
| SMILES | Cc1cc(CCCc2ccccc2)oc(=O)c1C(=O)N1C[C@H]2COC[C@@]2(CO)C1 |
| InChI | InChI=1S/C23H27NO5/c1-16-10-19(9-5-8-17-6-3-2-4-7-17)29-22(27)20(16)21(26)24-11-18-12-28-15-23(18,13-24)14-25/h2-4,6-7,10,18,25H,5,8-9,11-15H2,1H3/t18-,23-/m0/s1 |
| InChIKey | HJUTTYOFTHLEBR-MBSDFSHPSA-N |
| XLogP | 2.20 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |