C16H12N4O8 — CID 17050340
(E)-N-(4-methoxy-3,5-dinitrophenyl)-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 17050340) has the molecular formula C16H12N4O8 and a molecular weight of 388.29 g/mol. Its IUPAC name is (E)-N-(4-methoxy-3,5-dinitrophenyl)-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-methoxy-3,5-dinitrophenyl)-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17050340 |
| Molecular Formula | C16H12N4O8 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (E)-N-(4-methoxy-3,5-dinitrophenyl)-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | COc1c([N+](=O)[O-])cc(NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N4O8/c1-28-16-13(19(24)25)8-11(9-14(16)20(26)27)17-15(21)6-5-10-3-2-4-12(7-10)18(22)23/h2-9H,1H3,(H,17,21)/b6-5+ |
| InChIKey | JQBYAUWXLXCAND-AATRIKPKSA-N |
| XLogP | 3.07 |
| TPSA | 167.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|