About 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid
3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid (PubChem CID 170504435) has the molecular formula C13H12N4O2S
and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid.
Molecular Properties
| Compound Name | 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid |
| PubChem CID | 170504435 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1cc(-c2cscn2)c(C#N)c(N)n1 |
| InChI | InChI=1S/C13H12N4O2S/c1-7(2-12(18)19)10-3-8(11-5-20-6-16-11)9(4-14)13(15)17-10/h3,5-7H,2H2,1H3,(H2,15,17)(H,18,19) |
| InChIKey | HBTOZIZAZDIUKD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid?
The IUPAC name of 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid (CID 170504435) is 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid.
What is the SMILES notation for 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid?
The canonical SMILES for 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid is CC(CC(=O)O)c1cc(-c2cscn2)c(C#N)c(N)n1.
What is the InChIKey of 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid?
The InChIKey is HBTOZIZAZDIUKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O2S/c1-7(2-12(18)19)10-3-8(11-5-20-6-16-11)9(4-14)13(15)17-10/h3,5-7H,2H2,1H3,(H2,15,17)(H,18,19).
What are the key properties of 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid?
3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid has a molecular weight of 288.33 g/mol, XLogP of 2.24, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-amino-5-cyano-4-(1,3-thiazol-4-yl)-2-pyridinyl]butanoic acid is sourced from PubChem (CID 170504435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).