C18H27NO4 — CID 170504979
N-[2-(3-hydroxycyclobutyl)ethyl]-4-methyl-2-oxo-6-pentan-2-ylpyran-3-carboxamide (PubChem CID 170504979) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[2-(3-hydroxycyclobutyl)ethyl]-4-methyl-2-oxo-6-pentan-2-ylpyran-3-carboxamide.
| Compound Name | N-[2-(3-hydroxycyclobutyl)ethyl]-4-methyl-2-oxo-6-pentan-2-ylpyran-3-carboxamide |
|---|---|
| PubChem CID | 170504979 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-[2-(3-hydroxycyclobutyl)ethyl]-4-methyl-2-oxo-6-pentan-2-ylpyran-3-carboxamide |
| SMILES | CCCC(C)c1cc(C)c(C(=O)NCCC2CC(O)C2)c(=O)o1 |
| InChI | InChI=1S/C18H27NO4/c1-4-5-11(2)15-8-12(3)16(18(22)23-15)17(21)19-7-6-13-9-14(20)10-13/h8,11,13-14,20H,4-7,9-10H2,1-3H3,(H,19,21) |
| InChIKey | OJXAUPRLRZMYHS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |