About N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide
N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide (PubChem CID 170505407) has the molecular formula C19H20F2N2O3
and a molecular weight of 362.38 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide.
Molecular Properties
| Compound Name | N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide |
| PubChem CID | 170505407 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide |
| SMILES | Cc1cc(C2CCCNC2)oc(=O)c1C(=O)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H20F2N2O3/c1-11-7-16(13-3-2-6-22-10-13)26-19(25)17(11)18(24)23-9-12-4-5-14(20)15(21)8-12/h4-5,7-8,13,22H,2-3,6,9-10H2,1H3,(H,23,24) |
| InChIKey | CCEKDGBYVUXMCX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide?
The IUPAC name of N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide (CID 170505407) is N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide.
What is the SMILES notation for N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide?
The canonical SMILES for N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide is Cc1cc(C2CCCNC2)oc(=O)c1C(=O)NCc1ccc(F)c(F)c1.
What is the InChIKey of N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide?
The InChIKey is CCEKDGBYVUXMCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2N2O3/c1-11-7-16(13-3-2-6-22-10-13)26-19(25)17(11)18(24)23-9-12-4-5-14(20)15(21)8-12/h4-5,7-8,13,22H,2-3,6,9-10H2,1H3,(H,23,24).
What are the key properties of N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide?
N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide has a molecular weight of 362.38 g/mol, XLogP of 2.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-difluorophenyl)methyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide is sourced from PubChem (CID 170505407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).