C20H27NO6 — CID 170507921
3-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl]-4-methyl-6-(oxan-4-yl)pyran-2-one (PubChem CID 170507921) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl]-4-methyl-6-(oxan-4-yl)pyran-2-one.
| Compound Name | 3-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl]-4-methyl-6-(oxan-4-yl)pyran-2-one |
|---|---|
| PubChem CID | 170507921 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 3-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl]-4-methyl-6-(oxan-4-yl)pyran-2-one |
| SMILES | Cc1cc(C2CCOCC2)oc(=O)c1C(=O)N1CCO[C@H]2C[C@H](CO)C[C@@H]21 |
| InChI | InChI=1S/C20H27NO6/c1-12-8-16(14-2-5-25-6-3-14)27-20(24)18(12)19(23)21-4-7-26-17-10-13(11-22)9-15(17)21/h8,13-15,17,22H,2-7,9-11H2,1H3/t13-,15+,17+/m1/s1 |
| InChIKey | WEGVQFCDKDEMCP-KMFMINBZSA-N |
| XLogP | 1.45 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |