C36H40N4O7 — CID 170508101
(3S,8R)-14,24-dimethoxy-6-[2-(1-methylindol-3-yl)acetyl]-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione (PubChem CID 170508101) has the molecular formula C36H40N4O7 and a molecular weight of 640.74 g/mol. Its IUPAC name is (3S,8R)-14,24-dimethoxy-6-[2-(1-methylindol-3-yl)acetyl]-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione.
| Compound Name | (3S,8R)-14,24-dimethoxy-6-[2-(1-methylindol-3-yl)acetyl]-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione |
|---|---|
| PubChem CID | 170508101 |
| Molecular Formula | C36H40N4O7 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | (3S,8R)-14,24-dimethoxy-6-[2-(1-methylindol-3-yl)acetyl]-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione |
| SMILES | COc1cc2ccc1CNC(=O)CCc1ccc(OC)c(c1)OCC(=O)N[C@@H]1CN(C(=O)Cc3cn(C)c4ccccc34)CC[C@@H]1O2 |
| InChI | InChI=1S/C36H40N4O7/c1-39-20-25(27-6-4-5-7-29(27)39)17-36(43)40-15-14-30-28(21-40)38-35(42)22-46-33-16-23(8-12-31(33)44-2)9-13-34(41)37-19-24-10-11-26(47-30)18-32(24)45-3/h4-8,10-12,16,18,20,28,30H,9,13-15,17,19,21-22H2,1-3H3,(H,37,41)(H,38,42)/t28-,30+/m1/s1 |
| InChIKey | HDXKFEHJSHTJAG-DGPALRBDSA-N |
| XLogP | 3.54 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |