C21H24N2O2 — CID 170508464
5-[3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]-2-methyl-3H-isoindol-1-one (PubChem CID 170508464) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 5-[3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]-2-methyl-3H-isoindol-1-one.
| Compound Name | 5-[3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 170508464 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 5-[3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]-2-methyl-3H-isoindol-1-one |
| SMILES | CN1Cc2cc(-c3cccc(CN4CCC(O)CC4)c3)ccc2C1=O |
| InChI | InChI=1S/C21H24N2O2/c1-22-14-18-12-17(5-6-20(18)21(22)25)16-4-2-3-15(11-16)13-23-9-7-19(24)8-10-23/h2-6,11-12,19,24H,7-10,13-14H2,1H3 |
| InChIKey | YLWCEYADYBCBRD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |