C20H29N3O3 — CID 170510204
4-methyl-3-[4-(2-methylprop-2-enyl)piperazine-1-carbonyl]-6-piperidin-3-ylpyran-2-one (PubChem CID 170510204) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-methyl-3-[4-(2-methylprop-2-enyl)piperazine-1-carbonyl]-6-piperidin-3-ylpyran-2-one.
| Compound Name | 4-methyl-3-[4-(2-methylprop-2-enyl)piperazine-1-carbonyl]-6-piperidin-3-ylpyran-2-one |
|---|---|
| PubChem CID | 170510204 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-methyl-3-[4-(2-methylprop-2-enyl)piperazine-1-carbonyl]-6-piperidin-3-ylpyran-2-one |
| SMILES | C=C(C)CN1CCN(C(=O)c2c(C)cc(C3CCCNC3)oc2=O)CC1 |
| InChI | InChI=1S/C20H29N3O3/c1-14(2)13-22-7-9-23(10-8-22)19(24)18-15(3)11-17(26-20(18)25)16-5-4-6-21-12-16/h11,16,21H,1,4-10,12-13H2,2-3H3 |
| InChIKey | WTEDWLVUJXPAEN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|