C21H24N2O4 — CID 170510576
1-[3-[cyclohexyl(methyl)carbamoyl]phenyl]-4-methyl-2-oxopyridine-3-carboxylic acid (PubChem CID 170510576) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-[3-[cyclohexyl(methyl)carbamoyl]phenyl]-4-methyl-2-oxopyridine-3-carboxylic acid.
| Compound Name | 1-[3-[cyclohexyl(methyl)carbamoyl]phenyl]-4-methyl-2-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170510576 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-[3-[cyclohexyl(methyl)carbamoyl]phenyl]-4-methyl-2-oxopyridine-3-carboxylic acid |
| SMILES | Cc1ccn(-c2cccc(C(=O)N(C)C3CCCCC3)c2)c(=O)c1C(=O)O |
| InChI | InChI=1S/C21H24N2O4/c1-14-11-12-23(20(25)18(14)21(26)27)17-10-6-7-15(13-17)19(24)22(2)16-8-4-3-5-9-16/h6-7,10-13,16H,3-5,8-9H2,1-2H3,(H,26,27) |
| InChIKey | MHXLHYMHFJKOMY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |