C22H29N7O — CID 170510670
N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclohexane-1-carboxamide (PubChem CID 170510670) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclohexane-1-carboxamide.
| Compound Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 170510670 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1n[nH]c2c1CCCCC2)C1CCC(Nc2ncnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C22H29N7O/c30-22(24-12-19-16-4-2-1-3-5-18(16)28-29-19)14-6-8-15(9-7-14)27-21-17-10-11-23-20(17)25-13-26-21/h10-11,13-15H,1-9,12H2,(H,24,30)(H,28,29)(H2,23,25,26,27) |
| InChIKey | DXLZAMYCWLSYNY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |