About 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one
3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one (PubChem CID 170511464) has the molecular formula C17H23F2NO3
and a molecular weight of 327.37 g/mol. Its IUPAC name is 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one.
Molecular Properties
| Compound Name | 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one |
| PubChem CID | 170511464 |
| Molecular Formula | C17H23F2NO3 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one |
| SMILES | CCCC(C)c1cc(C)c(C(=O)N2CCCC(F)(F)C2)c(=O)o1 |
| InChI | InChI=1S/C17H23F2NO3/c1-4-6-11(2)13-9-12(3)14(16(22)23-13)15(21)20-8-5-7-17(18,19)10-20/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | WIUQPERBCRGUHB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one?
The IUPAC name of 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one (CID 170511464) is 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one.
What is the SMILES notation for 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one?
The canonical SMILES for 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one is CCCC(C)c1cc(C)c(C(=O)N2CCCC(F)(F)C2)c(=O)o1.
What is the InChIKey of 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one?
The InChIKey is WIUQPERBCRGUHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F2NO3/c1-4-6-11(2)13-9-12(3)14(16(22)23-13)15(21)20-8-5-7-17(18,19)10-20/h9,11H,4-8,10H2,1-3H3.
What are the key properties of 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one?
3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one has a molecular weight of 327.37 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluoropiperidine-1-carbonyl)-4-methyl-6-pentan-2-ylpyran-2-one is sourced from PubChem (CID 170511464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).