C21H36N6O — CID 170512232
(1S,2S,4R)-7-(3-methylbut-2-enyl)-2-(3-methylbutyl)-N-[3-(2H-tetrazol-5-yl)propyl]-7-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 170512232) has the molecular formula C21H36N6O and a molecular weight of 388.56 g/mol. Its IUPAC name is (1S,2S,4R)-7-(3-methylbut-2-enyl)-2-(3-methylbutyl)-N-[3-(2H-tetrazol-5-yl)propyl]-7-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,4R)-7-(3-methylbut-2-enyl)-2-(3-methylbutyl)-N-[3-(2H-tetrazol-5-yl)propyl]-7-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 170512232 |
| Molecular Formula | C21H36N6O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (1S,2S,4R)-7-(3-methylbut-2-enyl)-2-(3-methylbutyl)-N-[3-(2H-tetrazol-5-yl)propyl]-7-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC(C)=CCN1[C@@H]2CC[C@H]1[C@@](CCC(C)C)(C(=O)NCCCc1nn[nH]n1)C2 |
| InChI | InChI=1S/C21H36N6O/c1-15(2)9-11-21(20(28)22-12-5-6-19-23-25-26-24-19)14-17-7-8-18(21)27(17)13-10-16(3)4/h10,15,17-18H,5-9,11-14H2,1-4H3,(H,22,28)(H,23,24,25,26)/t17-,18+,21+/m1/s1 |
| InChIKey | JYTLOSYSPOKPLX-LQWHRVPQSA-N |
| XLogP | 2.87 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|