C29H36FN3O7 — CID 170512459
(3R,8R)-6-(3-ethoxypropanoyl)-25-fluoro-14-methoxy-2,12-dioxa-6,9,21-triazatetracyclo[21.3.1.113,17.03,8]octacosa-1(26),13,15,17(28),23(27),24-hexaene-10,20-dione (PubChem CID 170512459) has the molecular formula C29H36FN3O7 and a molecular weight of 557.62 g/mol. Its IUPAC name is (3R,8R)-6-(3-ethoxypropanoyl)-25-fluoro-14-methoxy-2,12-dioxa-6,9,21-triazatetracyclo[21.3.1.113,17.03,8]octacosa-1(26),13,15,17(28),23(27),24-hexaene-10,20-dione.
| Compound Name | (3R,8R)-6-(3-ethoxypropanoyl)-25-fluoro-14-methoxy-2,12-dioxa-6,9,21-triazatetracyclo[21.3.1.113,17.03,8]octacosa-1(26),13,15,17(28),23(27),24-hexaene-10,20-dione |
|---|---|
| PubChem CID | 170512459 |
| Molecular Formula | C29H36FN3O7 |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | (3R,8R)-6-(3-ethoxypropanoyl)-25-fluoro-14-methoxy-2,12-dioxa-6,9,21-triazatetracyclo[21.3.1.113,17.03,8]octacosa-1(26),13,15,17(28),23(27),24-hexaene-10,20-dione |
| SMILES | CCOCCC(=O)N1CC[C@H]2Oc3cc(F)cc(c3)CNC(=O)CCc3ccc(OC)c(c3)OCC(=O)N[C@@H]2C1 |
| InChI | InChI=1S/C29H36FN3O7/c1-3-38-11-9-29(36)33-10-8-24-23(17-33)32-28(35)18-39-26-14-19(4-6-25(26)37-2)5-7-27(34)31-16-20-12-21(30)15-22(13-20)40-24/h4,6,12-15,23-24H,3,5,7-11,16-18H2,1-2H3,(H,31,34)(H,32,35)/t23-,24-/m1/s1 |
| InChIKey | KBXCXLGGWASXKR-DNQXCXABSA-N |
| XLogP | 2.37 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|