C19H22N4O3 — CID 170512760
(3aS,6aS)-5-[[4-(2,4-dimethoxypyrimidin-5-yl)phenyl]methyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one (PubChem CID 170512760) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (3aS,6aS)-5-[[4-(2,4-dimethoxypyrimidin-5-yl)phenyl]methyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one.
| Compound Name | (3aS,6aS)-5-[[4-(2,4-dimethoxypyrimidin-5-yl)phenyl]methyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 170512760 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3aS,6aS)-5-[[4-(2,4-dimethoxypyrimidin-5-yl)phenyl]methyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
| SMILES | COc1ncc(-c2ccc(CN3C[C@@H]4CNC(=O)[C@@H]4C3)cc2)c(OC)n1 |
| InChI | InChI=1S/C19H22N4O3/c1-25-18-15(8-21-19(22-18)26-2)13-5-3-12(4-6-13)9-23-10-14-7-20-17(24)16(14)11-23/h3-6,8,14,16H,7,9-11H2,1-2H3,(H,20,24)/t14-,16+/m0/s1 |
| InChIKey | PERMMJVLASAGOB-GOEBONIOSA-N |
| XLogP | 1.34 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |