C21H23N9O2 — CID 170514826
(13R,17R)-24-(methylamino)-7-(trideuteriomethyl)-12-oxa-2,5,6,7,18,22,26,27-octazahexacyclo[18.5.2.13,10.04,8.013,17.023,27]octacosa-1(26),3,5,8,10(28),20,22,24-octaen-19-one (PubChem CID 170514826) has the molecular formula C21H23N9O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is (13R,17R)-24-(methylamino)-7-(trideuteriomethyl)-12-oxa-2,5,6,7,18,22,26,27-octazahexacyclo[18.5.2.13,10.04,8.013,17.023,27]octacosa-1(26),3,5,8,10(28),20,22,24-octaen-19-one.
| Compound Name | (13R,17R)-24-(methylamino)-7-(trideuteriomethyl)-12-oxa-2,5,6,7,18,22,26,27-octazahexacyclo[18.5.2.13,10.04,8.013,17.023,27]octacosa-1(26),3,5,8,10(28),20,22,24-octaen-19-one |
|---|---|
| PubChem CID | 170514826 |
| Molecular Formula | C21H23N9O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (13R,17R)-24-(methylamino)-7-(trideuteriomethyl)-12-oxa-2,5,6,7,18,22,26,27-octazahexacyclo[18.5.2.13,10.04,8.013,17.023,27]octacosa-1(26),3,5,8,10(28),20,22,24-octaen-19-one |
| SMILES | [2H]C([2H])([2H])n1nnc2c3cc(cc21)CO[C@@H]1CCC[C@H]1NC(=O)c1cnc2c(NC)cc(nn12)N3 |
| InChI | InChI=1S/C21H23N9O2/c1-22-14-8-18-24-13-6-11(7-15-19(13)26-28-29(15)2)10-32-17-5-3-4-12(17)25-21(31)16-9-23-20(14)30(16)27-18/h6-9,12,17,22H,3-5,10H2,1-2H3,(H,24,27)(H,25,31)/t12-,17-/m1/s1/i2D3 |
| InChIKey | SXYCXSLUFMWJMT-ZLPYKLTMSA-N |
| XLogP | 1.98 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|