C21H25BrN2O4S — CID 17051628
2-(4-bromo-2-tert-butylphenoxy)-N-[4-(prop-2-enylsulfamoyl)phenyl]acetamide (PubChem CID 17051628) has the molecular formula C21H25BrN2O4S and a molecular weight of 481.41 g/mol. Its IUPAC name is 2-(4-bromo-2-tert-butylphenoxy)-N-[4-(prop-2-enylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-bromo-2-tert-butylphenoxy)-N-[4-(prop-2-enylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17051628 |
| Molecular Formula | C21H25BrN2O4S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2-(4-bromo-2-tert-butylphenoxy)-N-[4-(prop-2-enylsulfamoyl)phenyl]acetamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(NC(=O)COc2ccc(Br)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25BrN2O4S/c1-5-12-23-29(26,27)17-9-7-16(8-10-17)24-20(25)14-28-19-11-6-15(22)13-18(19)21(2,3)4/h5-11,13,23H,1,12,14H2,2-4H3,(H,24,25) |
| InChIKey | HJZHEUJBXSSVNB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|