C29H33Cl3F2N4O6Si — CID 170516560
methyl N-[4-[6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-[2,4-difluoro-5-(2,2,2-trichloroethoxycarbonylamino)phenyl]-2-pyridinyl]-2-pyridinyl]carbamate (PubChem CID 170516560) has the molecular formula C29H33Cl3F2N4O6Si and a molecular weight of 706.05 g/mol. Its IUPAC name is methyl N-[4-[6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-[2,4-difluoro-5-(2,2,2-trichloroethoxycarbonylamino)phenyl]-2-pyridinyl]-2-pyridinyl]carbamate.
| Compound Name | methyl N-[4-[6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-[2,4-difluoro-5-(2,2,2-trichloroethoxycarbonylamino)phenyl]-2-pyridinyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 170516560 |
| Molecular Formula | C29H33Cl3F2N4O6Si |
| Molecular Weight | 706.05 g/mol |
| Exact Mass | 704.12 |
| IUPAC Name | methyl N-[4-[6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-4-[2,4-difluoro-5-(2,2,2-trichloroethoxycarbonylamino)phenyl]-2-pyridinyl]-2-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1cc(-c2cc(-c3cc(NC(=O)OCC(Cl)(Cl)Cl)c(F)cc3F)cc(OCCO[Si](C)(C)C(C)(C)C)n2)ccn1 |
| InChI | InChI=1S/C29H33Cl3F2N4O6Si/c1-28(2,3)45(5,6)44-10-9-42-25-13-18(11-22(36-25)17-7-8-35-24(12-17)38-26(39)41-4)19-14-23(21(34)15-20(19)33)37-27(40)43-16-29(30,31)32/h7-8,11-15H,9-10,16H2,1-6H3,(H,37,40)(H,35,38,39) |
| InChIKey | KAUCWWINCSKOCY-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.05 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|