C39H84O8Si4 — CID 170516656
methyl (3S,5S,6S)-5-[(2R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxy-6-methyloctanoate (PubChem CID 170516656) has the molecular formula C39H84O8Si4 and a molecular weight of 793.44 g/mol. Its IUPAC name is methyl (3S,5S,6S)-5-[(2R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxy-6-methyloctanoate.
| Compound Name | methyl (3S,5S,6S)-5-[(2R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxy-6-methyloctanoate |
|---|---|
| PubChem CID | 170516656 |
| Molecular Formula | C39H84O8Si4 |
| Molecular Weight | 793.44 g/mol |
| Exact Mass | 792.52 |
| IUPAC Name | methyl (3S,5S,6S)-5-[(2R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxy-6-methyloctanoate |
| SMILES | CC[C@H](C)[C@H](C[C@@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)O[C@@H]1O[C@@H](CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H84O8Si4/c1-24-28(2)30(25-29(26-32(40)41-15)45-49(18,19)37(6,7)8)43-35-34(47-51(22,23)39(12,13)14)33(46-50(20,21)38(9,10)11)31(44-35)27-42-48(16,17)36(3,4)5/h28-31,33-35H,24-27H2,1-23H3/t28-,29-,30-,31-,33?,34?,35+/m0/s1 |
| InChIKey | STIMAHMINJHNHM-KJOADCLJSA-N |
| XLogP | 11.29 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.44 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|