C38H82O8Si4 — CID 170516710
(3S,5S,6S)-5-[(2R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxy-6-methyloctanoic acid (PubChem CID 170516710) has the molecular formula C38H82O8Si4 and a molecular weight of 779.41 g/mol. Its IUPAC name is (3S,5S,6S)-5-[(2R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxy-6-methyloctanoic acid.
| Compound Name | (3S,5S,6S)-5-[(2R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxy-6-methyloctanoic acid |
|---|---|
| PubChem CID | 170516710 |
| Molecular Formula | C38H82O8Si4 |
| Molecular Weight | 779.41 g/mol |
| Exact Mass | 778.51 |
| IUPAC Name | (3S,5S,6S)-5-[(2R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxy-6-methyloctanoic acid |
| SMILES | CC[C@H](C)[C@H](C[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)O[C@@H]1O[C@@H](CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H82O8Si4/c1-23-27(2)29(24-28(25-31(39)40)44-48(17,18)36(6,7)8)42-34-33(46-50(21,22)38(12,13)14)32(45-49(19,20)37(9,10)11)30(43-34)26-41-47(15,16)35(3,4)5/h27-30,32-34H,23-26H2,1-22H3,(H,39,40)/t27-,28-,29-,30-,32?,33?,34+/m0/s1 |
| InChIKey | DWOQSMPARLVXSG-YPRWAXSASA-N |
| XLogP | 11.20 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.41 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|