C20H31BN2O3 — CID 170516875
N-methyl-N-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-3-yl]acetamide (PubChem CID 170516875) has the molecular formula C20H31BN2O3 and a molecular weight of 358.29 g/mol. Its IUPAC name is N-methyl-N-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-3-yl]acetamide.
| Compound Name | N-methyl-N-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 170516875 |
| Molecular Formula | C20H31BN2O3 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-methyl-N-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-3-yl]acetamide |
| SMILES | CC(=O)N(C)C1CCCN(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)C1 |
| InChI | InChI=1S/C20H31BN2O3/c1-15(24)22(6)18-11-8-12-23(14-18)17-10-7-9-16(13-17)21-25-19(2,3)20(4,5)26-21/h7,9-10,13,18H,8,11-12,14H2,1-6H3 |
| InChIKey | JOZBLMCYCXZJNZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|