C45H38N2O — CID 170517078
2-(2,4-diphenyl-1-benzofuran-6-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole (PubChem CID 170517078) has the molecular formula C45H38N2O and a molecular weight of 622.81 g/mol. Its IUPAC name is 2-(2,4-diphenyl-1-benzofuran-6-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole.
| Compound Name | 2-(2,4-diphenyl-1-benzofuran-6-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 170517078 |
| Molecular Formula | C45H38N2O |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | 2-(2,4-diphenyl-1-benzofuran-6-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2cc(-c3ccccc3)c3cc(-c4ccccc4)oc3c2)nc2ccccc21 |
| InChI | InChI=1S/C45H38N2O/c1-29(2)36-24-34(31-16-8-5-9-17-31)25-37(30(3)4)44(36)47-41-23-15-14-22-40(41)46-45(47)35-26-38(32-18-10-6-11-19-32)39-28-42(48-43(39)27-35)33-20-12-7-13-21-33/h5-30H,1-4H3 |
| InChIKey | MYMNMYYNGPXWLS-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |