C33H32F3NSe — CID 170517329
7-(4-tert-butylnaphthalen-2-yl)-3-methyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-6H-selenopheno[2,3-b]pyridin-7-ium-6-ide (PubChem CID 170517329) has the molecular formula C33H32F3NSe and a molecular weight of 578.58 g/mol. Its IUPAC name is 7-(4-tert-butylnaphthalen-2-yl)-3-methyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-6H-selenopheno[2,3-b]pyridin-7-ium-6-ide.
| Compound Name | 7-(4-tert-butylnaphthalen-2-yl)-3-methyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-6H-selenopheno[2,3-b]pyridin-7-ium-6-ide |
|---|---|
| PubChem CID | 170517329 |
| Molecular Formula | C33H32F3NSe |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 7-(4-tert-butylnaphthalen-2-yl)-3-methyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-6H-selenopheno[2,3-b]pyridin-7-ium-6-ide |
| SMILES | Cc1c(-c2ccc(CC(C)(C)C(F)(F)F)cc2)[se]c2c1cc[c-][n+]2-c1cc(C(C)(C)C)c2ccccc2c1 |
| InChI | InChI=1S/C33H32F3NSe/c1-21-26-12-9-17-37(25-18-24-10-7-8-11-27(24)28(19-25)31(2,3)4)30(26)38-29(21)23-15-13-22(14-16-23)20-32(5,6)33(34,35)36/h7-16,18-19H,20H2,1-6H3 |
| InChIKey | RJDZYBZMRRKCMG-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|