C36H24N2 — CID 170517385
4-carbazol-9-yl-1,2,3,5,6,7,8-heptadeuterio-9-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]carbazole (PubChem CID 170517385) has the molecular formula C36H24N2 and a molecular weight of 500.70 g/mol. Its IUPAC name is 4-carbazol-9-yl-1,2,3,5,6,7,8-heptadeuterio-9-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]carbazole.
| Compound Name | 4-carbazol-9-yl-1,2,3,5,6,7,8-heptadeuterio-9-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]carbazole |
|---|---|
| PubChem CID | 170517385 |
| Molecular Formula | C36H24N2 |
| Molecular Weight | 500.70 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 4-carbazol-9-yl-1,2,3,5,6,7,8-heptadeuterio-9-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c(-n3c4c([2H])c([2H])c([2H])c([2H])c4c4c(-n5c6ccccc6c6ccccc65)c([2H])c([2H])c([2H])c43)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C36H24N2/c1-2-12-25(13-3-1)26-14-10-15-27(24-26)37-33-21-9-6-18-30(33)36-34(37)22-11-23-35(36)38-31-19-7-4-16-28(31)29-17-5-8-20-32(29)38/h1-24H/i1D,2D,3D,6D,9D,10D,11D,12D,13D,14D,15D,18D,21D,22D,23D,24D |
| InChIKey | VNPSFRAXCXHOLC-YQXOTKKKSA-N |
| XLogP | 9.55 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.70 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |