C42H28N2 — CID 170517655
1,2,3,4-tetradeuterio-9-[9-[3-[2,4,6-trideuterio-3-(2,3,5,6-tetradeuteriophenyl)phenyl]phenyl]carbazol-3-yl]carbazole (PubChem CID 170517655) has the molecular formula C42H28N2 and a molecular weight of 571.77 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-9-[9-[3-[2,4,6-trideuterio-3-(2,3,5,6-tetradeuteriophenyl)phenyl]phenyl]carbazol-3-yl]carbazole.
| Compound Name | 1,2,3,4-tetradeuterio-9-[9-[3-[2,4,6-trideuterio-3-(2,3,5,6-tetradeuteriophenyl)phenyl]phenyl]carbazol-3-yl]carbazole |
|---|---|
| PubChem CID | 170517655 |
| Molecular Formula | C42H28N2 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | 1,2,3,4-tetradeuterio-9-[9-[3-[2,4,6-trideuterio-3-(2,3,5,6-tetradeuteriophenyl)phenyl]phenyl]carbazol-3-yl]carbazole |
| SMILES | [2H]c1cc([2H])c([2H])c(-c2c([2H])cc([2H])c(-c3cccc(-n4c5ccccc5c5cc(-n6c7ccccc7c7c([2H])c([2H])c([2H])c([2H])c76)ccc54)c3)c2[2H])c1[2H] |
| InChI | InChI=1S/C42H28N2/c1-2-12-29(13-3-1)30-14-10-15-31(26-30)32-16-11-17-33(27-32)43-41-23-9-6-20-37(41)38-28-34(24-25-42(38)43)44-39-21-7-4-18-35(39)36-19-5-8-22-40(36)44/h1-28H/i2D,3D,4D,7D,12D,13D,14D,15D,18D,21D,26D |
| InChIKey | YBWRXKCEEONKHW-LXGXJUNYSA-N |
| XLogP | 11.21 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |