C9H5F9N2O2 — CID 170517792
1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione (PubChem CID 170517792) has the molecular formula C9H5F9N2O2 and a molecular weight of 344.13 g/mol. Its IUPAC name is 1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione.
| Compound Name | 1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170517792 |
| Molecular Formula | C9H5F9N2O2 |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione |
| SMILES | Cn1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H5F9N2O2/c1-20-2-3(4(21)19-5(20)22)6(10,11)7(12,13)8(14,15)9(16,17)18/h2H,1H3,(H,19,21,22) |
| InChIKey | CDFQQLBXVKJSKB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|