C48H30N2S — CID 170517861
2-carbazol-9-yl-9-[8-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzothiophen-1-yl]carbazole (PubChem CID 170517861) has the molecular formula C48H30N2S and a molecular weight of 675.90 g/mol. Its IUPAC name is 2-carbazol-9-yl-9-[8-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzothiophen-1-yl]carbazole.
| Compound Name | 2-carbazol-9-yl-9-[8-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzothiophen-1-yl]carbazole |
|---|---|
| PubChem CID | 170517861 |
| Molecular Formula | C48H30N2S |
| Molecular Weight | 675.90 g/mol |
| Exact Mass | 675.27 |
| IUPAC Name | 2-carbazol-9-yl-9-[8-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]dibenzothiophen-1-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c(-c3ccc4sc5cccc(-n6c7ccccc7c7ccc(-n8c9ccccc9c9ccccc98)cc76)c5c4c3)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C48H30N2S/c1-2-12-31(13-3-1)32-14-10-15-33(28-32)34-24-27-46-40(29-34)48-44(22-11-23-47(48)51-46)50-43-21-9-6-18-38(43)39-26-25-35(30-45(39)50)49-41-19-7-4-16-36(41)37-17-5-8-20-42(37)49/h1-30H/i1D,2D,3D,10D,12D,13D,14D,15D,28D |
| InChIKey | IXFTYANDBAZDPW-DLCIFBBESA-N |
| XLogP | 13.58 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.90 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |